ethyl carbamate;2-phenylacetic acid

C11H15NO4 — CID 153376104

IUPACethyl carbamate;2-phenylacetic acid
SMILESCCOC(N)=O.O=C(O)Cc1ccccc1
InChIInChI=1S/C8H8O2.C3H7NO2/c9-8(10)6-7-4-2-1-3-5-7;1-2-6-3(4)5/h1-5H,6H2,(H,9,10);2H2,1H3,(H2,4,5)
InChIKeyVLSGAXWQDJOLKS-UHFFFAOYSA-N
MW225.24 g/mol
LogP1.42
Rot. Bonds3

About ethyl carbamate;2-phenylacetic acid

ethyl carbamate;2-phenylacetic acid (PubChem CID 153376104) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is ethyl carbamate;2-phenylacetic acid.

Molecular Properties

Compound Nameethyl carbamate;2-phenylacetic acid
PubChem CID153376104
Molecular FormulaC11H15NO4
Molecular Weight225.24 g/mol
Exact Mass225.10
IUPAC Nameethyl carbamate;2-phenylacetic acid
SMILESCCOC(N)=O.O=C(O)Cc1ccccc1
InChIInChI=1S/C8H8O2.C3H7NO2/c9-8(10)6-7-4-2-1-3-5-7;1-2-6-3(4)5/h1-5H,6H2,(H,9,10);2H2,1H3,(H2,4,5)
InChIKeyVLSGAXWQDJOLKS-UHFFFAOYSA-N
XLogP1.42
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.24
LogP ≤ 51.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze ethyl carbamate;2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl carbamate;2-phenylacetic acid?
The IUPAC name of ethyl carbamate;2-phenylacetic acid (CID 153376104) is ethyl carbamate;2-phenylacetic acid.
What is the SMILES notation for ethyl carbamate;2-phenylacetic acid?
The canonical SMILES for ethyl carbamate;2-phenylacetic acid is CCOC(N)=O.O=C(O)Cc1ccccc1.
What is the InChIKey of ethyl carbamate;2-phenylacetic acid?
The InChIKey is VLSGAXWQDJOLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C3H7NO2/c9-8(10)6-7-4-2-1-3-5-7;1-2-6-3(4)5/h1-5H,6H2,(H,9,10);2H2,1H3,(H2,4,5).
What are the key properties of ethyl carbamate;2-phenylacetic acid?
ethyl carbamate;2-phenylacetic acid has a molecular weight of 225.24 g/mol, XLogP of 1.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbamate;2-phenylacetic acid is sourced from PubChem (CID 153376104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).