chloro hypochlorite;2-phenylacetic acid

C8H8Cl2O3 — CID 174297587

IUPACchloro hypochlorite;2-phenylacetic acid
SMILESClOCl.O=C(O)Cc1ccccc1
InChIInChI=1S/C8H8O2.Cl2O/c9-8(10)6-7-4-2-1-3-5-7;1-3-2/h1-5H,6H2,(H,9,10);
InChIKeySARQZAZQOFUIMF-UHFFFAOYSA-N
MW223.06 g/mol
LogP2.62
Rot. Bonds2

About chloro hypochlorite;2-phenylacetic acid

chloro hypochlorite;2-phenylacetic acid (PubChem CID 174297587) has the molecular formula C8H8Cl2O3 and a molecular weight of 223.06 g/mol. Its IUPAC name is chloro hypochlorite;2-phenylacetic acid.

Molecular Properties

Compound Namechloro hypochlorite;2-phenylacetic acid
PubChem CID174297587
Molecular FormulaC8H8Cl2O3
Molecular Weight223.06 g/mol
Exact Mass221.99
IUPAC Namechloro hypochlorite;2-phenylacetic acid
SMILESClOCl.O=C(O)Cc1ccccc1
InChIInChI=1S/C8H8O2.Cl2O/c9-8(10)6-7-4-2-1-3-5-7;1-3-2/h1-5H,6H2,(H,9,10);
InChIKeySARQZAZQOFUIMF-UHFFFAOYSA-N
XLogP2.62
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.06
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze chloro hypochlorite;2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloro hypochlorite;2-phenylacetic acid?
The IUPAC name of chloro hypochlorite;2-phenylacetic acid (CID 174297587) is chloro hypochlorite;2-phenylacetic acid.
What is the SMILES notation for chloro hypochlorite;2-phenylacetic acid?
The canonical SMILES for chloro hypochlorite;2-phenylacetic acid is ClOCl.O=C(O)Cc1ccccc1.
What is the InChIKey of chloro hypochlorite;2-phenylacetic acid?
The InChIKey is SARQZAZQOFUIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.Cl2O/c9-8(10)6-7-4-2-1-3-5-7;1-3-2/h1-5H,6H2,(H,9,10);.
What are the key properties of chloro hypochlorite;2-phenylacetic acid?
chloro hypochlorite;2-phenylacetic acid has a molecular weight of 223.06 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro hypochlorite;2-phenylacetic acid is sourced from PubChem (CID 174297587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).