About 3-oxobutanoic acid;2-phenylacetic acid
3-oxobutanoic acid;2-phenylacetic acid (PubChem CID 91330939) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-oxobutanoic acid;2-phenylacetic acid.
Molecular Properties
| Compound Name | 3-oxobutanoic acid;2-phenylacetic acid |
| PubChem CID | 91330939 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-oxobutanoic acid;2-phenylacetic acid |
| SMILES | CC(=O)CC(=O)O.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C4H6O3/c9-8(10)6-7-4-2-1-3-5-7;1-3(5)2-4(6)7/h1-5H,6H2,(H,9,10);2H2,1H3,(H,6,7) |
| InChIKey | YNKIQEQWCRCLJK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoic acid;2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoic acid;2-phenylacetic acid?
The IUPAC name of 3-oxobutanoic acid;2-phenylacetic acid (CID 91330939) is 3-oxobutanoic acid;2-phenylacetic acid.
What is the SMILES notation for 3-oxobutanoic acid;2-phenylacetic acid?
The canonical SMILES for 3-oxobutanoic acid;2-phenylacetic acid is CC(=O)CC(=O)O.O=C(O)Cc1ccccc1.
What is the InChIKey of 3-oxobutanoic acid;2-phenylacetic acid?
The InChIKey is YNKIQEQWCRCLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C4H6O3/c9-8(10)6-7-4-2-1-3-5-7;1-3(5)2-4(6)7/h1-5H,6H2,(H,9,10);2H2,1H3,(H,6,7).
What are the key properties of 3-oxobutanoic acid;2-phenylacetic acid?
3-oxobutanoic acid;2-phenylacetic acid has a molecular weight of 238.24 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoic acid;2-phenylacetic acid is sourced from PubChem (CID 91330939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).