About naphthalene;2-phenylacetic acid
naphthalene;2-phenylacetic acid (PubChem CID 174965541) has the molecular formula C18H16O2
and a molecular weight of 264.32 g/mol. Its IUPAC name is naphthalene;2-phenylacetic acid.
Molecular Properties
| Compound Name | naphthalene;2-phenylacetic acid |
| PubChem CID | 174965541 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | naphthalene;2-phenylacetic acid |
| SMILES | O=C(O)Cc1ccccc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C8H8O2/c1-2-6-10-8-4-3-7-9(10)5-1;9-8(10)6-7-4-2-1-3-5-7/h1-8H;1-5H,6H2,(H,9,10) |
| InChIKey | WRUDZHSLUDCKMI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze naphthalene;2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;2-phenylacetic acid?
The IUPAC name of naphthalene;2-phenylacetic acid (CID 174965541) is naphthalene;2-phenylacetic acid.
What is the SMILES notation for naphthalene;2-phenylacetic acid?
The canonical SMILES for naphthalene;2-phenylacetic acid is O=C(O)Cc1ccccc1.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;2-phenylacetic acid?
The InChIKey is WRUDZHSLUDCKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C8H8O2/c1-2-6-10-8-4-3-7-9(10)5-1;9-8(10)6-7-4-2-1-3-5-7/h1-8H;1-5H,6H2,(H,9,10).
What are the key properties of naphthalene;2-phenylacetic acid?
naphthalene;2-phenylacetic acid has a molecular weight of 264.32 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;2-phenylacetic acid is sourced from PubChem (CID 174965541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).