About benzene;1-phenylpropan-2-one
benzene;1-phenylpropan-2-one (PubChem CID 21430852) has the molecular formula C57H58O
and a molecular weight of 759.09 g/mol. Its IUPAC name is benzene;1-phenylpropan-2-one.
Molecular Properties
| Compound Name | benzene;1-phenylpropan-2-one |
| PubChem CID | 21430852 |
| Molecular Formula | C57H58O |
| Molecular Weight | 759.09 g/mol |
| Exact Mass | 758.45 |
| IUPAC Name | benzene;1-phenylpropan-2-one |
| SMILES | CC(=O)Cc1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C9H10O.8C6H6/c1-8(10)7-9-5-3-2-4-6-9;8*1-2-4-6-5-3-1/h2-6H,7H2,1H3;8*1-6H |
| InChIKey | HBIPKPBGASCDMT-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 759.09 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;1-phenylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-phenylpropan-2-one?
The IUPAC name of benzene;1-phenylpropan-2-one (CID 21430852) is benzene;1-phenylpropan-2-one.
What is the SMILES notation for benzene;1-phenylpropan-2-one?
The canonical SMILES for benzene;1-phenylpropan-2-one is CC(=O)Cc1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.c1ccccc1.
What is the InChIKey of benzene;1-phenylpropan-2-one?
The InChIKey is HBIPKPBGASCDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.8C6H6/c1-8(10)7-9-5-3-2-4-6-9;8*1-2-4-6-5-3-1/h2-6H,7H2,1H3;8*1-6H.
What are the key properties of benzene;1-phenylpropan-2-one?
benzene;1-phenylpropan-2-one has a molecular weight of 759.09 g/mol, XLogP of 15.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-phenylpropan-2-one is sourced from PubChem (CID 21430852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).