About formyl formate;1-phenylpropan-2-one
formyl formate;1-phenylpropan-2-one (PubChem CID 174973991) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is formyl formate;1-phenylpropan-2-one.
Molecular Properties
| Compound Name | formyl formate;1-phenylpropan-2-one |
| PubChem CID | 174973991 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | formyl formate;1-phenylpropan-2-one |
| SMILES | CC(=O)Cc1ccccc1.O=COC=O |
| InChI | InChI=1S/C9H10O.C2H2O3/c1-8(10)7-9-5-3-2-4-6-9;3-1-5-2-4/h2-6H,7H2,1H3;1-2H |
| InChIKey | BWXSCQKWMSNHRM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formyl formate;1-phenylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl formate;1-phenylpropan-2-one?
The IUPAC name of formyl formate;1-phenylpropan-2-one (CID 174973991) is formyl formate;1-phenylpropan-2-one.
What is the SMILES notation for formyl formate;1-phenylpropan-2-one?
The canonical SMILES for formyl formate;1-phenylpropan-2-one is CC(=O)Cc1ccccc1.O=COC=O.
What is the InChIKey of formyl formate;1-phenylpropan-2-one?
The InChIKey is BWXSCQKWMSNHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C2H2O3/c1-8(10)7-9-5-3-2-4-6-9;3-1-5-2-4/h2-6H,7H2,1H3;1-2H.
What are the key properties of formyl formate;1-phenylpropan-2-one?
formyl formate;1-phenylpropan-2-one has a molecular weight of 208.21 g/mol, XLogP of 1.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formyl formate;1-phenylpropan-2-one is sourced from PubChem (CID 174973991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).