C15H14O — CID 100945080
1,3-diphenyl(213C)propan-2-one (PubChem CID 100945080) has the molecular formula C15H14O and a molecular weight of 211.27 g/mol. Its IUPAC name is 1,3-diphenyl(213C)propan-2-one.
| Compound Name | 1,3-diphenyl(213C)propan-2-one |
|---|---|
| PubChem CID | 100945080 |
| Molecular Formula | C15H14O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1,3-diphenyl(213C)propan-2-one |
| SMILES | O=[13C](Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H14O/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2/i15+1 |
| InChIKey | YFKBXYGUSOXJGS-XPOOIHDOSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |