C29H42O2 — CID 159058422
1,3-diphenylpropan-2-one;ethane;methoxymethylbenzene (PubChem CID 159058422) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-one;ethane;methoxymethylbenzene.
| Compound Name | 1,3-diphenylpropan-2-one;ethane;methoxymethylbenzene |
|---|---|
| PubChem CID | 159058422 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 1,3-diphenylpropan-2-one;ethane;methoxymethylbenzene |
| SMILES | CC.CC.CC.COCc1ccccc1.O=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H14O.C8H10O.3C2H6/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;1-9-7-8-5-3-2-4-6-8;3*1-2/h1-10H,11-12H2;2-6H,7H2,1H3;3*1-2H3 |
| InChIKey | JYDQPNVGEAHKPU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |