About methoxymethylbenzene;2-(methoxymethyl)benzoic acid
methoxymethylbenzene;2-(methoxymethyl)benzoic acid (PubChem CID 175486457) has the molecular formula C17H20O4
and a molecular weight of 288.34 g/mol. Its IUPAC name is methoxymethylbenzene;2-(methoxymethyl)benzoic acid.
Molecular Properties
| Compound Name | methoxymethylbenzene;2-(methoxymethyl)benzoic acid |
| PubChem CID | 175486457 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | methoxymethylbenzene;2-(methoxymethyl)benzoic acid |
| SMILES | COCc1ccccc1.COCc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H10O3.C8H10O/c1-12-6-7-4-2-3-5-8(7)9(10)11;1-9-7-8-5-3-2-4-6-8/h2-5H,6H2,1H3,(H,10,11);2-6H,7H2,1H3 |
| InChIKey | BPLCSXUTNZRKGC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methoxymethylbenzene;2-(methoxymethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethylbenzene;2-(methoxymethyl)benzoic acid?
The IUPAC name of methoxymethylbenzene;2-(methoxymethyl)benzoic acid (CID 175486457) is methoxymethylbenzene;2-(methoxymethyl)benzoic acid.
What is the SMILES notation for methoxymethylbenzene;2-(methoxymethyl)benzoic acid?
The canonical SMILES for methoxymethylbenzene;2-(methoxymethyl)benzoic acid is COCc1ccccc1.COCc1ccccc1C(=O)O.
What is the InChIKey of methoxymethylbenzene;2-(methoxymethyl)benzoic acid?
The InChIKey is BPLCSXUTNZRKGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C8H10O/c1-12-6-7-4-2-3-5-8(7)9(10)11;1-9-7-8-5-3-2-4-6-8/h2-5H,6H2,1H3,(H,10,11);2-6H,7H2,1H3.
What are the key properties of methoxymethylbenzene;2-(methoxymethyl)benzoic acid?
methoxymethylbenzene;2-(methoxymethyl)benzoic acid has a molecular weight of 288.34 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethylbenzene;2-(methoxymethyl)benzoic acid is sourced from PubChem (CID 175486457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).