C10H13NO2 — CID 60753373
2-(methoxymethyl)-N-methylbenzamide (PubChem CID 60753373) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-(methoxymethyl)-N-methylbenzamide.
| Compound Name | 2-(methoxymethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 60753373 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-(methoxymethyl)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1COC |
| InChI | InChI=1S/C10H13NO2/c1-11-10(12)9-6-4-3-5-8(9)7-13-2/h3-6H,7H2,1-2H3,(H,11,12) |
| InChIKey | SMSKQUJYXBFAKG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |