C11H15NO2 — CID 143102947
3-(methoxymethyl)-N,2-dimethylbenzamide (PubChem CID 143102947) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(methoxymethyl)-N,2-dimethylbenzamide.
| Compound Name | 3-(methoxymethyl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 143102947 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-(methoxymethyl)-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(COC)c1C |
| InChI | InChI=1S/C11H15NO2/c1-8-9(7-14-3)5-4-6-10(8)11(13)12-2/h4-6H,7H2,1-3H3,(H,12,13) |
| InChIKey | ZGZFFYQRTRMHMS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |