C17H19NO3 — CID 63182538
N-(2-hydroxy-1-phenylethyl)-2-(methoxymethyl)benzamide (PubChem CID 63182538) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenylethyl)-2-(methoxymethyl)benzamide.
| Compound Name | N-(2-hydroxy-1-phenylethyl)-2-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 63182538 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(2-hydroxy-1-phenylethyl)-2-(methoxymethyl)benzamide |
| SMILES | COCc1ccccc1C(=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-21-12-14-9-5-6-10-15(14)17(20)18-16(11-19)13-7-3-2-4-8-13/h2-10,16,19H,11-12H2,1H3,(H,18,20) |
| InChIKey | CCOYPUVLIWDSCP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |