About 3-oxobutanoic acid;1-phenylethanone
3-oxobutanoic acid;1-phenylethanone (PubChem CID 67450141) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-oxobutanoic acid;1-phenylethanone.
Molecular Properties
| Compound Name | 3-oxobutanoic acid;1-phenylethanone |
| PubChem CID | 67450141 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-oxobutanoic acid;1-phenylethanone |
| SMILES | CC(=O)CC(=O)O.CC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O.C4H6O3/c1-7(9)8-5-3-2-4-6-8;1-3(5)2-4(6)7/h2-6H,1H3;2H2,1H3,(H,6,7) |
| InChIKey | JVSSJEKTYDVAED-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoic acid;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoic acid;1-phenylethanone?
The IUPAC name of 3-oxobutanoic acid;1-phenylethanone (CID 67450141) is 3-oxobutanoic acid;1-phenylethanone.
What is the SMILES notation for 3-oxobutanoic acid;1-phenylethanone?
The canonical SMILES for 3-oxobutanoic acid;1-phenylethanone is CC(=O)CC(=O)O.CC(=O)c1ccccc1.
What is the InChIKey of 3-oxobutanoic acid;1-phenylethanone?
The InChIKey is JVSSJEKTYDVAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C4H6O3/c1-7(9)8-5-3-2-4-6-8;1-3(5)2-4(6)7/h2-6H,1H3;2H2,1H3,(H,6,7).
What are the key properties of 3-oxobutanoic acid;1-phenylethanone?
3-oxobutanoic acid;1-phenylethanone has a molecular weight of 222.24 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoic acid;1-phenylethanone is sourced from PubChem (CID 67450141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).