About 2-fluoroacetic acid;1-phenylethanone
2-fluoroacetic acid;1-phenylethanone (PubChem CID 174359405) has the molecular formula C10H11FO3
and a molecular weight of 198.19 g/mol. Its IUPAC name is 2-fluoroacetic acid;1-phenylethanone.
Molecular Properties
| Compound Name | 2-fluoroacetic acid;1-phenylethanone |
| PubChem CID | 174359405 |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-fluoroacetic acid;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=C(O)CF |
| InChI | InChI=1S/C8H8O.C2H3FO2/c1-7(9)8-5-3-2-4-6-8;3-1-2(4)5/h2-6H,1H3;1H2,(H,4,5) |
| InChIKey | ZQAXWXMOJWRLFT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoroacetic acid;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroacetic acid;1-phenylethanone?
The IUPAC name of 2-fluoroacetic acid;1-phenylethanone (CID 174359405) is 2-fluoroacetic acid;1-phenylethanone.
What is the SMILES notation for 2-fluoroacetic acid;1-phenylethanone?
The canonical SMILES for 2-fluoroacetic acid;1-phenylethanone is CC(=O)c1ccccc1.O=C(O)CF.
What is the InChIKey of 2-fluoroacetic acid;1-phenylethanone?
The InChIKey is ZQAXWXMOJWRLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H3FO2/c1-7(9)8-5-3-2-4-6-8;3-1-2(4)5/h2-6H,1H3;1H2,(H,4,5).
What are the key properties of 2-fluoroacetic acid;1-phenylethanone?
2-fluoroacetic acid;1-phenylethanone has a molecular weight of 198.19 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroacetic acid;1-phenylethanone is sourced from PubChem (CID 174359405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).