About pentan-2-one;1-phenylethanone
pentan-2-one;1-phenylethanone (PubChem CID 142883835) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is pentan-2-one;1-phenylethanone.
Molecular Properties
| Compound Name | pentan-2-one;1-phenylethanone |
| PubChem CID | 142883835 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | pentan-2-one;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.CCCC(C)=O |
| InChI | InChI=1S/C8H8O.C5H10O/c1-7(9)8-5-3-2-4-6-8;1-3-4-5(2)6/h2-6H,1H3;3-4H2,1-2H3 |
| InChIKey | IPRGNLPXZLZLKA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentan-2-one;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-one;1-phenylethanone?
The IUPAC name of pentan-2-one;1-phenylethanone (CID 142883835) is pentan-2-one;1-phenylethanone.
What is the SMILES notation for pentan-2-one;1-phenylethanone?
The canonical SMILES for pentan-2-one;1-phenylethanone is CC(=O)c1ccccc1.CCCC(C)=O.
What is the InChIKey of pentan-2-one;1-phenylethanone?
The InChIKey is IPRGNLPXZLZLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C5H10O/c1-7(9)8-5-3-2-4-6-8;1-3-4-5(2)6/h2-6H,1H3;3-4H2,1-2H3.
What are the key properties of pentan-2-one;1-phenylethanone?
pentan-2-one;1-phenylethanone has a molecular weight of 206.28 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-one;1-phenylethanone is sourced from PubChem (CID 142883835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).