About 1-(4-methylphenyl)ethanone;pentan-2-one;toluene
1-(4-methylphenyl)ethanone;pentan-2-one;toluene (PubChem CID 157441299) has the molecular formula C21H28O2
and a molecular weight of 312.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)ethanone;pentan-2-one;toluene.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)ethanone;pentan-2-one;toluene |
| PubChem CID | 157441299 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-(4-methylphenyl)ethanone;pentan-2-one;toluene |
| SMILES | CC(=O)c1ccc(C)cc1.CCCC(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C9H10O.C7H8.C5H10O/c1-7-3-5-9(6-4-7)8(2)10;1-7-5-3-2-4-6-7;1-3-4-5(2)6/h3-6H,1-2H3;2-6H,1H3;3-4H2,1-2H3 |
| InChIKey | BRSBDOWBWUJNBJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methylphenyl)ethanone;pentan-2-one;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)ethanone;pentan-2-one;toluene?
The IUPAC name of 1-(4-methylphenyl)ethanone;pentan-2-one;toluene (CID 157441299) is 1-(4-methylphenyl)ethanone;pentan-2-one;toluene.
What is the SMILES notation for 1-(4-methylphenyl)ethanone;pentan-2-one;toluene?
The canonical SMILES for 1-(4-methylphenyl)ethanone;pentan-2-one;toluene is CC(=O)c1ccc(C)cc1.CCCC(C)=O.Cc1ccccc1.
What is the InChIKey of 1-(4-methylphenyl)ethanone;pentan-2-one;toluene?
The InChIKey is BRSBDOWBWUJNBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C7H8.C5H10O/c1-7-3-5-9(6-4-7)8(2)10;1-7-5-3-2-4-6-7;1-3-4-5(2)6/h3-6H,1-2H3;2-6H,1H3;3-4H2,1-2H3.
What are the key properties of 1-(4-methylphenyl)ethanone;pentan-2-one;toluene?
1-(4-methylphenyl)ethanone;pentan-2-one;toluene has a molecular weight of 312.45 g/mol, XLogP of 5.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)ethanone;pentan-2-one;toluene is sourced from PubChem (CID 157441299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).