C13H14O2 — CID 173106795
ethyl (4E)-5-phenylpenta-2,4-dienoate (PubChem CID 173106795) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is ethyl (4E)-5-phenylpenta-2,4-dienoate.
| Compound Name | ethyl (4E)-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 173106795 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | ethyl (4E)-5-phenylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H14O2/c1-2-15-13(14)11-7-6-10-12-8-4-3-5-9-12/h3-11H,2H2,1H3/b10-6+,11-7? |
| InChIKey | NLKBBWBCWHTRAJ-WYXIJEACSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|