C19H22O6 — CID 168973637
diethyl (2S)-2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate (PubChem CID 168973637) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is diethyl (2S)-2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate.
| Compound Name | diethyl (2S)-2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate |
|---|---|
| PubChem CID | 168973637 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | diethyl (2S)-2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate |
| SMILES | CCOC(=O)C[C@H](OC(=O)/C=C/C=C/c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C19H22O6/c1-3-23-18(21)14-16(19(22)24-4-2)25-17(20)13-9-8-12-15-10-6-5-7-11-15/h5-13,16H,3-4,14H2,1-2H3/b12-8+,13-9+/t16-/m0/s1 |
| InChIKey | RILNAVQTQRBUOY-LVPLIOQOSA-N |
| XLogP | 2.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|