C17H18O6 — CID 170020960
dimethyl 2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate (PubChem CID 170020960) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is dimethyl 2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate.
| Compound Name | dimethyl 2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate |
|---|---|
| PubChem CID | 170020960 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | dimethyl 2-[(2E,4E)-5-phenylpenta-2,4-dienoyl]oxybutanedioate |
| SMILES | COC(=O)CC(OC(=O)/C=C/C=C/c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C17H18O6/c1-21-16(19)12-14(17(20)22-2)23-15(18)11-7-6-10-13-8-4-3-5-9-13/h3-11,14H,12H2,1-2H3/b10-6+,11-7+ |
| InChIKey | PTWOZEQFHUZQGO-JMQWPVDRSA-N |
| XLogP | 1.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|