C13H16ClNO2 — CID 140968194
ethyl 5-(4-aminophenyl)penta-2,4-dienoate;hydrochloride (PubChem CID 140968194) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is ethyl 5-(4-aminophenyl)penta-2,4-dienoate;hydrochloride.
| Compound Name | ethyl 5-(4-aminophenyl)penta-2,4-dienoate;hydrochloride |
|---|---|
| PubChem CID | 140968194 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | ethyl 5-(4-aminophenyl)penta-2,4-dienoate;hydrochloride |
| SMILES | CCOC(=O)C=CC=Cc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C13H15NO2.ClH/c1-2-16-13(15)6-4-3-5-11-7-9-12(14)10-8-11;/h3-10H,2,14H2,1H3;1H |
| InChIKey | NEOMOZAKAZOGPK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|