C12H12ClNO — CID 6065980
(3E,5E)-6-(4-aminophenyl)-1-chlorohexa-3,5-dien-2-one (PubChem CID 6065980) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is (3E,5E)-6-(4-aminophenyl)-1-chlorohexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-6-(4-aminophenyl)-1-chlorohexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 6065980 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (3E,5E)-6-(4-aminophenyl)-1-chlorohexa-3,5-dien-2-one |
| SMILES | Nc1ccc(/C=C/C=C/C(=O)CCl)cc1 |
| InChI | InChI=1S/C12H12ClNO/c13-9-12(15)4-2-1-3-10-5-7-11(14)8-6-10/h1-8H,9,14H2/b3-1+,4-2+ |
| InChIKey | BBYBRKPYPPSHCV-ZPUQHVIOSA-N |
| XLogP | 2.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|