C17H17N — CID 89165666
4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]aniline (PubChem CID 89165666) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]aniline.
| Compound Name | 4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 89165666 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]aniline |
| SMILES | Cc1ccc(/C=C/C=C/c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H17N/c1-14-6-8-15(9-7-14)4-2-3-5-16-10-12-17(18)13-11-16/h2-13H,18H2,1H3/b4-2+,5-3+ |
| InChIKey | DFOAYHFRFBNBKN-ZUVMSYQZSA-N |
| XLogP | 4.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|