C18H18N2 — CID 59911946
methyl-[4-[4-(4-methylphenyl)buta-1,3-dienyl]phenyl]diazene (PubChem CID 59911946) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is methyl-[4-[4-(4-methylphenyl)buta-1,3-dienyl]phenyl]diazene.
| Compound Name | methyl-[4-[4-(4-methylphenyl)buta-1,3-dienyl]phenyl]diazene |
|---|---|
| PubChem CID | 59911946 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | methyl-[4-[4-(4-methylphenyl)buta-1,3-dienyl]phenyl]diazene |
| SMILES | C/N=N/c1ccc(C=CC=Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18N2/c1-15-7-9-16(10-8-15)5-3-4-6-17-11-13-18(14-12-17)20-19-2/h3-14H,1-2H3/b5-3?,6-4?,20-19+ |
| InChIKey | VEEQKGYBFFSVKH-VDVABSDUSA-N |
| XLogP | 5.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|