C19H20 — CID 173274077
2,4-dimethyl-1-[4-(4-methylphenyl)buta-1,3-dienyl]benzene (PubChem CID 173274077) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2,4-dimethyl-1-[4-(4-methylphenyl)buta-1,3-dienyl]benzene.
| Compound Name | 2,4-dimethyl-1-[4-(4-methylphenyl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 173274077 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2,4-dimethyl-1-[4-(4-methylphenyl)buta-1,3-dienyl]benzene |
| SMILES | Cc1ccc(C=CC=Cc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H20/c1-15-8-11-18(12-9-15)6-4-5-7-19-13-10-16(2)14-17(19)3/h4-14H,1-3H3 |
| InChIKey | DFBNRVMTLHCZSN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|