C31H33N — CID 158838824
methane;3-methyl-N,N-bis(4-methylphenyl)-4-[(E)-2-(4-methylphenyl)ethenyl]aniline (PubChem CID 158838824) has the molecular formula C31H33N and a molecular weight of 419.61 g/mol. Its IUPAC name is methane;3-methyl-N,N-bis(4-methylphenyl)-4-[(E)-2-(4-methylphenyl)ethenyl]aniline.
| Compound Name | methane;3-methyl-N,N-bis(4-methylphenyl)-4-[(E)-2-(4-methylphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 158838824 |
| Molecular Formula | C31H33N |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | methane;3-methyl-N,N-bis(4-methylphenyl)-4-[(E)-2-(4-methylphenyl)ethenyl]aniline |
| SMILES | C.Cc1ccc(/C=C/c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C30H29N.CH4/c1-22-5-11-26(12-6-22)13-14-27-15-20-30(21-25(27)4)31(28-16-7-23(2)8-17-28)29-18-9-24(3)10-19-29;/h5-21H,1-4H3;1H4/b14-13+; |
| InChIKey | IXZAGZQNAOPDDX-IERUDJENSA-N |
| XLogP | 9.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|