C53H49N — CID 59366099
N-[4-[2-[4-[2-[4-[bis(4-methylphenyl)methyl]phenyl]ethenyl]-2,5-dimethylphenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 59366099) has the molecular formula C53H49N and a molecular weight of 699.98 g/mol. Its IUPAC name is N-[4-[2-[4-[2-[4-[bis(4-methylphenyl)methyl]phenyl]ethenyl]-2,5-dimethylphenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[2-[4-[2-[4-[bis(4-methylphenyl)methyl]phenyl]ethenyl]-2,5-dimethylphenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 59366099 |
| Molecular Formula | C53H49N |
| Molecular Weight | 699.98 g/mol |
| Exact Mass | 699.39 |
| IUPAC Name | N-[4-[2-[4-[2-[4-[bis(4-methylphenyl)methyl]phenyl]ethenyl]-2,5-dimethylphenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)c2ccc(C=Cc3cc(C)c(C=Cc4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C53H49N/c1-37-7-21-45(22-8-37)53(46-23-9-38(2)10-24-46)47-25-15-43(16-26-47)17-27-48-35-42(6)49(36-41(48)5)28-18-44-19-33-52(34-20-44)54(50-29-11-39(3)12-30-50)51-31-13-40(4)14-32-51/h7-36,53H,1-6H3 |
| InChIKey | BTKURXOBJCDPCZ-UHFFFAOYSA-N |
| XLogP | 14.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.98 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|