C18H22 — CID 161062923
2,4-dimethyl-1-[(E)-2-(4-methylphenyl)ethenyl]benzene;methane (PubChem CID 161062923) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2,4-dimethyl-1-[(E)-2-(4-methylphenyl)ethenyl]benzene;methane.
| Compound Name | 2,4-dimethyl-1-[(E)-2-(4-methylphenyl)ethenyl]benzene;methane |
|---|---|
| PubChem CID | 161062923 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2,4-dimethyl-1-[(E)-2-(4-methylphenyl)ethenyl]benzene;methane |
| SMILES | C.Cc1ccc(/C=C/c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C17H18.CH4/c1-13-4-7-16(8-5-13)9-11-17-10-6-14(2)12-15(17)3;/h4-12H,1-3H3;1H4/b11-9+; |
| InChIKey | UDQAHMMVWZELHL-LBEJWNQZSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|