About 1-(2-chloroethenyl)-2,4-dimethylbenzene
1-(2-chloroethenyl)-2,4-dimethylbenzene (PubChem CID 54480012) has the molecular formula C10H11Cl
and a molecular weight of 166.65 g/mol. Its IUPAC name is 1-(2-chloroethenyl)-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(2-chloroethenyl)-2,4-dimethylbenzene |
| PubChem CID | 54480012 |
| Molecular Formula | C10H11Cl |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-(2-chloroethenyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C=CCl)c(C)c1 |
| InChI | InChI=1S/C10H11Cl/c1-8-3-4-10(5-6-11)9(2)7-8/h3-7H,1-2H3 |
| InChIKey | XOINERJRMIFSIP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2-chloroethenyl)-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethenyl)-2,4-dimethylbenzene?
The IUPAC name of 1-(2-chloroethenyl)-2,4-dimethylbenzene (CID 54480012) is 1-(2-chloroethenyl)-2,4-dimethylbenzene.
What is the SMILES notation for 1-(2-chloroethenyl)-2,4-dimethylbenzene?
The canonical SMILES for 1-(2-chloroethenyl)-2,4-dimethylbenzene is Cc1ccc(C=CCl)c(C)c1.
What is the InChIKey of 1-(2-chloroethenyl)-2,4-dimethylbenzene?
The InChIKey is XOINERJRMIFSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl/c1-8-3-4-10(5-6-11)9(2)7-8/h3-7H,1-2H3.
What are the key properties of 1-(2-chloroethenyl)-2,4-dimethylbenzene?
1-(2-chloroethenyl)-2,4-dimethylbenzene has a molecular weight of 166.65 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethenyl)-2,4-dimethylbenzene is sourced from PubChem (CID 54480012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).