About 1,2,3-trimethylbenzene
1,2,3-trimethylbenzene (PubChem CID 10686) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is 1,2,3-trimethylbenzene.
Molecular Properties
| Compound Name | 1,2,3-trimethylbenzene |
| PubChem CID | 10686 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 1,2,3-trimethylbenzene |
| SMILES | Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
| InChIKey | FYGHSUNMUKGBRK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,3-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethylbenzene?
The IUPAC name of 1,2,3-trimethylbenzene (CID 10686) is 1,2,3-trimethylbenzene.
What is the SMILES notation for 1,2,3-trimethylbenzene?
The canonical SMILES for 1,2,3-trimethylbenzene is Cc1cccc(C)c1C.
What is the InChIKey of 1,2,3-trimethylbenzene?
The InChIKey is FYGHSUNMUKGBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3.
What are the key properties of 1,2,3-trimethylbenzene?
1,2,3-trimethylbenzene has a molecular weight of 120.19 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethylbenzene is sourced from PubChem (CID 10686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).