C12H15Cl — CID 82076018
1-[(E)-4-chlorobut-1-enyl]-2,4-dimethylbenzene (PubChem CID 82076018) has the molecular formula C12H15Cl and a molecular weight of 194.70 g/mol. Its IUPAC name is 1-[(E)-4-chlorobut-1-enyl]-2,4-dimethylbenzene.
| Compound Name | 1-[(E)-4-chlorobut-1-enyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 82076018 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.70 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[(E)-4-chlorobut-1-enyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(/C=C/CCCl)c(C)c1 |
| InChI | InChI=1S/C12H15Cl/c1-10-6-7-12(11(2)9-10)5-3-4-8-13/h3,5-7,9H,4,8H2,1-2H3/b5-3+ |
| InChIKey | WYPIXIGPRDJMDE-HWKANZROSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|