C11H13F — CID 142233895
1-(3-fluoroprop-1-enyl)-2,4-dimethylbenzene (PubChem CID 142233895) has the molecular formula C11H13F and a molecular weight of 164.22 g/mol. Its IUPAC name is 1-(3-fluoroprop-1-enyl)-2,4-dimethylbenzene.
| Compound Name | 1-(3-fluoroprop-1-enyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 142233895 |
| Molecular Formula | C11H13F |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1-(3-fluoroprop-1-enyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C=CCF)c(C)c1 |
| InChI | InChI=1S/C11H13F/c1-9-5-6-11(4-3-7-12)10(2)8-9/h3-6,8H,7H2,1-2H3 |
| InChIKey | TXWNHIZOYYOSDC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |