C25H28 — CID 143322291
2,4-dimethyl-1-[(E)-2-phenylethenyl]benzene;1-ethyl-2-methylbenzene (PubChem CID 143322291) has the molecular formula C25H28 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2,4-dimethyl-1-[(E)-2-phenylethenyl]benzene;1-ethyl-2-methylbenzene.
| Compound Name | 2,4-dimethyl-1-[(E)-2-phenylethenyl]benzene;1-ethyl-2-methylbenzene |
|---|---|
| PubChem CID | 143322291 |
| Molecular Formula | C25H28 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2,4-dimethyl-1-[(E)-2-phenylethenyl]benzene;1-ethyl-2-methylbenzene |
| SMILES | CCc1ccccc1C.Cc1ccc(/C=C/c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H16.C9H12/c1-13-8-10-16(14(2)12-13)11-9-15-6-4-3-5-7-15;1-3-9-7-5-4-6-8(9)2/h3-12H,1-2H3;4-7H,3H2,1-2H3/b11-9+; |
| InChIKey | AWCLKGYPXLCOML-LBEJWNQZSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|