About 1-ethyl-2-methylbenzene;propane;toluene
1-ethyl-2-methylbenzene;propane;toluene (PubChem CID 159725880) has the molecular formula C19H28
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-ethyl-2-methylbenzene;propane;toluene.
Molecular Properties
| Compound Name | 1-ethyl-2-methylbenzene;propane;toluene |
| PubChem CID | 159725880 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-ethyl-2-methylbenzene;propane;toluene |
| SMILES | CCC.CCc1ccccc1C.Cc1ccccc1 |
| InChI | InChI=1S/C9H12.C7H8.C3H8/c1-3-9-7-5-4-6-8(9)2;1-7-5-3-2-4-6-7;1-3-2/h4-7H,3H2,1-2H3;2-6H,1H3;3H2,1-2H3 |
| InChIKey | NAPWXMWFMAGVLS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-2-methylbenzene;propane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methylbenzene;propane;toluene?
The IUPAC name of 1-ethyl-2-methylbenzene;propane;toluene (CID 159725880) is 1-ethyl-2-methylbenzene;propane;toluene.
What is the SMILES notation for 1-ethyl-2-methylbenzene;propane;toluene?
The canonical SMILES for 1-ethyl-2-methylbenzene;propane;toluene is CCC.CCc1ccccc1C.Cc1ccccc1.
What is the InChIKey of 1-ethyl-2-methylbenzene;propane;toluene?
The InChIKey is NAPWXMWFMAGVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C7H8.C3H8/c1-3-9-7-5-4-6-8(9)2;1-7-5-3-2-4-6-7;1-3-2/h4-7H,3H2,1-2H3;2-6H,1H3;3H2,1-2H3.
What are the key properties of 1-ethyl-2-methylbenzene;propane;toluene?
1-ethyl-2-methylbenzene;propane;toluene has a molecular weight of 256.43 g/mol, XLogP of 5.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methylbenzene;propane;toluene is sourced from PubChem (CID 159725880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).