C19H26 — CID 158943282
1-ethyl-2,3-dimethylbenzene;1-ethyl-2-methylbenzene (PubChem CID 158943282) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylbenzene;1-ethyl-2-methylbenzene.
| Compound Name | 1-ethyl-2,3-dimethylbenzene;1-ethyl-2-methylbenzene |
|---|---|
| PubChem CID | 158943282 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-ethyl-2,3-dimethylbenzene;1-ethyl-2-methylbenzene |
| SMILES | CCc1cccc(C)c1C.CCc1ccccc1C |
| InChI | InChI=1S/C10H14.C9H12/c1-4-10-7-5-6-8(2)9(10)3;1-3-9-7-5-4-6-8(9)2/h5-7H,4H2,1-3H3;4-7H,3H2,1-2H3 |
| InChIKey | JKMZXGNIEXTVPQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |