About 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol
1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol (PubChem CID 174751633) has the molecular formula C21H22O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol.
Molecular Properties
| Compound Name | 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol |
| PubChem CID | 174751633 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol |
| SMILES | CCc1ccccc1C.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H10O2.C9H12/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-3-9-7-5-4-6-8(9)2/h1-8,13-14H;4-7H,3H2,1-2H3 |
| InChIKey | ISFCFXDSQXXCEQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol?
The IUPAC name of 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol (CID 174751633) is 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol.
What is the SMILES notation for 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol?
The canonical SMILES for 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol is CCc1ccccc1C.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol?
The InChIKey is ISFCFXDSQXXCEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C9H12/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-3-9-7-5-4-6-8(9)2/h1-8,13-14H;4-7H,3H2,1-2H3.
What are the key properties of 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol?
1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol has a molecular weight of 306.41 g/mol, XLogP of 5.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methylbenzene;4-(4-hydroxyphenyl)phenol is sourced from PubChem (CID 174751633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).