C24H30 — CID 174742983
benzene;1,2-diethylbenzene;1,2-xylene (PubChem CID 174742983) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is benzene;1,2-diethylbenzene;1,2-xylene.
| Compound Name | benzene;1,2-diethylbenzene;1,2-xylene |
|---|---|
| PubChem CID | 174742983 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | benzene;1,2-diethylbenzene;1,2-xylene |
| SMILES | CCc1ccccc1CC.Cc1ccccc1C.c1ccccc1 |
| InChI | InChI=1S/C10H14.C8H10.C6H6/c1-3-9-7-5-6-8-10(9)4-2;1-7-5-3-4-6-8(7)2;1-2-4-6-5-3-1/h5-8H,3-4H2,1-2H3;3-6H,1-2H3;1-6H |
| InChIKey | HQOPXQJOTWVGOK-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |