About benzene;1,2-xylene
benzene;1,2-xylene (PubChem CID 161464493) has the molecular formula C20H22
and a molecular weight of 262.40 g/mol. Its IUPAC name is benzene;1,2-xylene.
Molecular Properties
| Compound Name | benzene;1,2-xylene |
| PubChem CID | 161464493 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | benzene;1,2-xylene |
| SMILES | Cc1ccccc1C.c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C8H10.2C6H6/c1-7-5-3-4-6-8(7)2;2*1-2-4-6-5-3-1/h3-6H,1-2H3;2*1-6H |
| InChIKey | WCGAPDJGTHJQJG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,2-xylene?
The IUPAC name of benzene;1,2-xylene (CID 161464493) is benzene;1,2-xylene.
What is the SMILES notation for benzene;1,2-xylene?
The canonical SMILES for benzene;1,2-xylene is Cc1ccccc1C.c1ccccc1.c1ccccc1.
What is the InChIKey of benzene;1,2-xylene?
The InChIKey is WCGAPDJGTHJQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2C6H6/c1-7-5-3-4-6-8(7)2;2*1-2-4-6-5-3-1/h3-6H,1-2H3;2*1-6H.
What are the key properties of benzene;1,2-xylene?
benzene;1,2-xylene has a molecular weight of 262.40 g/mol, XLogP of 5.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,2-xylene is sourced from PubChem (CID 161464493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).