About azane;1,2-xylene;hydrate
azane;1,2-xylene;hydrate (PubChem CID 158522930) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is azane;1,2-xylene;hydrate.
Molecular Properties
| Compound Name | azane;1,2-xylene;hydrate |
| PubChem CID | 158522930 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | azane;1,2-xylene;hydrate |
| SMILES | Cc1ccccc1C.N.O |
| InChI | InChI=1S/C8H10.H3N.H2O/c1-7-5-3-4-6-8(7)2;;/h3-6H,1-2H3;1H3;1H2 |
| InChIKey | VSVIRJYTOQMTER-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1,2-xylene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2-xylene;hydrate?
The IUPAC name of azane;1,2-xylene;hydrate (CID 158522930) is azane;1,2-xylene;hydrate.
What is the SMILES notation for azane;1,2-xylene;hydrate?
The canonical SMILES for azane;1,2-xylene;hydrate is Cc1ccccc1C.N.O.
What is the InChIKey of azane;1,2-xylene;hydrate?
The InChIKey is VSVIRJYTOQMTER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.H3N.H2O/c1-7-5-3-4-6-8(7)2;;/h3-6H,1-2H3;1H3;1H2.
What are the key properties of azane;1,2-xylene;hydrate?
azane;1,2-xylene;hydrate has a molecular weight of 141.21 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2-xylene;hydrate is sourced from PubChem (CID 158522930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).