About ethane;1,2-xylene;dihydrochloride
ethane;1,2-xylene;dihydrochloride (PubChem CID 174677530) has the molecular formula C10H18Cl2
and a molecular weight of 209.16 g/mol. Its IUPAC name is ethane;1,2-xylene;dihydrochloride.
Molecular Properties
| Compound Name | ethane;1,2-xylene;dihydrochloride |
| PubChem CID | 174677530 |
| Molecular Formula | C10H18Cl2 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | ethane;1,2-xylene;dihydrochloride |
| SMILES | CC.Cc1ccccc1C.Cl.Cl |
| InChI | InChI=1S/C8H10.C2H6.2ClH/c1-7-5-3-4-6-8(7)2;1-2;;/h3-6H,1-2H3;1-2H3;2*1H |
| InChIKey | APQVTGCEYWQCJV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1,2-xylene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,2-xylene;dihydrochloride?
The IUPAC name of ethane;1,2-xylene;dihydrochloride (CID 174677530) is ethane;1,2-xylene;dihydrochloride.
What is the SMILES notation for ethane;1,2-xylene;dihydrochloride?
The canonical SMILES for ethane;1,2-xylene;dihydrochloride is CC.Cc1ccccc1C.Cl.Cl.
What is the InChIKey of ethane;1,2-xylene;dihydrochloride?
The InChIKey is APQVTGCEYWQCJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C2H6.2ClH/c1-7-5-3-4-6-8(7)2;1-2;;/h3-6H,1-2H3;1-2H3;2*1H.
What are the key properties of ethane;1,2-xylene;dihydrochloride?
ethane;1,2-xylene;dihydrochloride has a molecular weight of 209.16 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,2-xylene;dihydrochloride is sourced from PubChem (CID 174677530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).