About hydrazine;1,2-xylene;dihydrochloride
hydrazine;1,2-xylene;dihydrochloride (PubChem CID 172851293) has the molecular formula C8H16Cl2N2
and a molecular weight of 211.14 g/mol. Its IUPAC name is hydrazine;1,2-xylene;dihydrochloride.
Molecular Properties
| Compound Name | hydrazine;1,2-xylene;dihydrochloride |
| PubChem CID | 172851293 |
| Molecular Formula | C8H16Cl2N2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | hydrazine;1,2-xylene;dihydrochloride |
| SMILES | Cc1ccccc1C.Cl.Cl.NN |
| InChI | InChI=1S/C8H10.2ClH.H4N2/c1-7-5-3-4-6-8(7)2;;;1-2/h3-6H,1-2H3;2*1H;1-2H2 |
| InChIKey | YCIHKZJIDDBWGP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;1,2-xylene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;1,2-xylene;dihydrochloride?
The IUPAC name of hydrazine;1,2-xylene;dihydrochloride (CID 172851293) is hydrazine;1,2-xylene;dihydrochloride.
What is the SMILES notation for hydrazine;1,2-xylene;dihydrochloride?
The canonical SMILES for hydrazine;1,2-xylene;dihydrochloride is Cc1ccccc1C.Cl.Cl.NN.
What is the InChIKey of hydrazine;1,2-xylene;dihydrochloride?
The InChIKey is YCIHKZJIDDBWGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2ClH.H4N2/c1-7-5-3-4-6-8(7)2;;;1-2/h3-6H,1-2H3;2*1H;1-2H2.
What are the key properties of hydrazine;1,2-xylene;dihydrochloride?
hydrazine;1,2-xylene;dihydrochloride has a molecular weight of 211.14 g/mol, XLogP of 1.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;1,2-xylene;dihydrochloride is sourced from PubChem (CID 172851293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).