About 1,2-xylene;tetrahydrobromide
1,2-xylene;tetrahydrobromide (PubChem CID 172843014) has the molecular formula C8H14Br4
and a molecular weight of 429.82 g/mol. Its IUPAC name is 1,2-xylene;tetrahydrobromide.
Molecular Properties
| Compound Name | 1,2-xylene;tetrahydrobromide |
| PubChem CID | 172843014 |
| Molecular Formula | C8H14Br4 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 425.78 |
| IUPAC Name | 1,2-xylene;tetrahydrobromide |
| SMILES | Br.Br.Br.Br.Cc1ccccc1C |
| InChI | InChI=1S/C8H10.4BrH/c1-7-5-3-4-6-8(7)2;;;;/h3-6H,1-2H3;4*1H |
| InChIKey | XAZAOQIHQKGPCT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-xylene;tetrahydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-xylene;tetrahydrobromide?
The IUPAC name of 1,2-xylene;tetrahydrobromide (CID 172843014) is 1,2-xylene;tetrahydrobromide.
What is the SMILES notation for 1,2-xylene;tetrahydrobromide?
The canonical SMILES for 1,2-xylene;tetrahydrobromide is Br.Br.Br.Br.Cc1ccccc1C.
What is the InChIKey of 1,2-xylene;tetrahydrobromide?
The InChIKey is XAZAOQIHQKGPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.4BrH/c1-7-5-3-4-6-8(7)2;;;;/h3-6H,1-2H3;4*1H.
What are the key properties of 1,2-xylene;tetrahydrobromide?
1,2-xylene;tetrahydrobromide has a molecular weight of 429.82 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-xylene;tetrahydrobromide is sourced from PubChem (CID 172843014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).