About 1,2-xylene;trihydrochloride
1,2-xylene;trihydrochloride (PubChem CID 70594732) has the molecular formula C8H13Cl3
and a molecular weight of 215.55 g/mol. Its IUPAC name is 1,2-xylene;trihydrochloride.
Molecular Properties
| Compound Name | 1,2-xylene;trihydrochloride |
| PubChem CID | 70594732 |
| Molecular Formula | C8H13Cl3 |
| Molecular Weight | 215.55 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 1,2-xylene;trihydrochloride |
| SMILES | Cc1ccccc1C.Cl.Cl.Cl |
| InChI | InChI=1S/C8H10.3ClH/c1-7-5-3-4-6-8(7)2;;;/h3-6H,1-2H3;3*1H |
| InChIKey | ATILHNJXGPAMCS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-xylene;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-xylene;trihydrochloride?
The IUPAC name of 1,2-xylene;trihydrochloride (CID 70594732) is 1,2-xylene;trihydrochloride.
What is the SMILES notation for 1,2-xylene;trihydrochloride?
The canonical SMILES for 1,2-xylene;trihydrochloride is Cc1ccccc1C.Cl.Cl.Cl.
What is the InChIKey of 1,2-xylene;trihydrochloride?
The InChIKey is ATILHNJXGPAMCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.3ClH/c1-7-5-3-4-6-8(7)2;;;/h3-6H,1-2H3;3*1H.
What are the key properties of 1,2-xylene;trihydrochloride?
1,2-xylene;trihydrochloride has a molecular weight of 215.55 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-xylene;trihydrochloride is sourced from PubChem (CID 70594732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).