About azane;1,2-xylene
azane;1,2-xylene (PubChem CID 174280305) has the molecular formula C8H43N11
and a molecular weight of 293.51 g/mol. Its IUPAC name is azane;1,2-xylene.
Molecular Properties
| Compound Name | azane;1,2-xylene |
| PubChem CID | 174280305 |
| Molecular Formula | C8H43N11 |
| Molecular Weight | 293.51 g/mol |
| Exact Mass | 293.37 |
| IUPAC Name | azane;1,2-xylene |
| SMILES | Cc1ccccc1C.N.N.N.N.N.N.N.N.N.N.N |
| InChI | InChI=1S/C8H10.11H3N/c1-7-5-3-4-6-8(7)2;;;;;;;;;;;/h3-6H,1-2H3;11*1H3 |
| InChIKey | VOEFTKOUJGRPFZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 385.00 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 293.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze azane;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2-xylene?
The IUPAC name of azane;1,2-xylene (CID 174280305) is azane;1,2-xylene.
What is the SMILES notation for azane;1,2-xylene?
The canonical SMILES for azane;1,2-xylene is Cc1ccccc1C.N.N.N.N.N.N.N.N.N.N.N.
What is the InChIKey of azane;1,2-xylene?
The InChIKey is VOEFTKOUJGRPFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.11H3N/c1-7-5-3-4-6-8(7)2;;;;;;;;;;;/h3-6H,1-2H3;11*1H3.
What are the key properties of azane;1,2-xylene?
azane;1,2-xylene has a molecular weight of 293.51 g/mol, XLogP of 4.09, 0 rotatable bonds, 11 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2-xylene is sourced from PubChem (CID 174280305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).