About vanadium;1,2-xylene
vanadium;1,2-xylene (PubChem CID 143581691) has the molecular formula C8H10V
and a molecular weight of 157.11 g/mol. Its IUPAC name is vanadium;1,2-xylene.
Molecular Properties
| Compound Name | vanadium;1,2-xylene |
| PubChem CID | 143581691 |
| Molecular Formula | C8H10V |
| Molecular Weight | 157.11 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | vanadium;1,2-xylene |
| SMILES | Cc1ccccc1C.[V] |
| InChI | InChI=1S/C8H10.V/c1-7-5-3-4-6-8(7)2;/h3-6H,1-2H3; |
| InChIKey | FYFSOKGIMQCNOK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.11 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze vanadium;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of vanadium;1,2-xylene?
The IUPAC name of vanadium;1,2-xylene (CID 143581691) is vanadium;1,2-xylene.
What is the SMILES notation for vanadium;1,2-xylene?
The canonical SMILES for vanadium;1,2-xylene is Cc1ccccc1C.[V].
What is the InChIKey of vanadium;1,2-xylene?
The InChIKey is FYFSOKGIMQCNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.V/c1-7-5-3-4-6-8(7)2;/h3-6H,1-2H3;.
What are the key properties of vanadium;1,2-xylene?
vanadium;1,2-xylene has a molecular weight of 157.11 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for vanadium;1,2-xylene is sourced from PubChem (CID 143581691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).