C12H18O6 — CID 89388803
carbonic acid;1,2-diethylbenzene (PubChem CID 89388803) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is carbonic acid;1,2-diethylbenzene.
| Compound Name | carbonic acid;1,2-diethylbenzene |
|---|---|
| PubChem CID | 89388803 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | carbonic acid;1,2-diethylbenzene |
| SMILES | CCc1ccccc1CC.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C10H14.2CH2O3/c1-3-9-7-5-6-8-10(9)4-2;2*2-1(3)4/h5-8H,3-4H2,1-2H3;2*(H2,2,3,4) |
| InChIKey | BRJNMLZADVDDRW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |