About azane;2-(2-ethylphenyl)acetic acid
azane;2-(2-ethylphenyl)acetic acid (PubChem CID 70384426) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is azane;2-(2-ethylphenyl)acetic acid.
Molecular Properties
| Compound Name | azane;2-(2-ethylphenyl)acetic acid |
| PubChem CID | 70384426 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | azane;2-(2-ethylphenyl)acetic acid |
| SMILES | CCc1ccccc1CC(=O)O.N |
| InChI | InChI=1S/C10H12O2.H3N/c1-2-8-5-3-4-6-9(8)7-10(11)12;/h3-6H,2,7H2,1H3,(H,11,12);1H3 |
| InChIKey | UTNDMHZWYJJYOB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-(2-ethylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(2-ethylphenyl)acetic acid?
The IUPAC name of azane;2-(2-ethylphenyl)acetic acid (CID 70384426) is azane;2-(2-ethylphenyl)acetic acid.
What is the SMILES notation for azane;2-(2-ethylphenyl)acetic acid?
The canonical SMILES for azane;2-(2-ethylphenyl)acetic acid is CCc1ccccc1CC(=O)O.N.
What is the InChIKey of azane;2-(2-ethylphenyl)acetic acid?
The InChIKey is UTNDMHZWYJJYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.H3N/c1-2-8-5-3-4-6-9(8)7-10(11)12;/h3-6H,2,7H2,1H3,(H,11,12);1H3.
What are the key properties of azane;2-(2-ethylphenyl)acetic acid?
azane;2-(2-ethylphenyl)acetic acid has a molecular weight of 181.23 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(2-ethylphenyl)acetic acid is sourced from PubChem (CID 70384426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).