About 2-(2-methylphenyl)acetic acid
2-(2-methylphenyl)acetic acid (PubChem CID 67440217) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(2-methylphenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)acetic acid |
| PubChem CID | 67440217 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-(2-methylphenyl)acetic acid |
| SMILES | Cc1ccccc1CC(=O)O.Cc1ccccc1CC(=O)O |
| InChI | InChI=1S/2C9H10O2/c2*1-7-4-2-3-5-8(7)6-9(10)11/h2*2-5H,6H2,1H3,(H,10,11) |
| InChIKey | OGVTXUTXLMFNRY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-methylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)acetic acid?
The IUPAC name of 2-(2-methylphenyl)acetic acid (CID 67440217) is 2-(2-methylphenyl)acetic acid.
What is the SMILES notation for 2-(2-methylphenyl)acetic acid?
The canonical SMILES for 2-(2-methylphenyl)acetic acid is Cc1ccccc1CC(=O)O.Cc1ccccc1CC(=O)O.
What is the InChIKey of 2-(2-methylphenyl)acetic acid?
The InChIKey is OGVTXUTXLMFNRY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H10O2/c2*1-7-4-2-3-5-8(7)6-9(10)11/h2*2-5H,6H2,1H3,(H,10,11).
What are the key properties of 2-(2-methylphenyl)acetic acid?
2-(2-methylphenyl)acetic acid has a molecular weight of 300.35 g/mol, XLogP of 3.24, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)acetic acid is sourced from PubChem (CID 67440217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).