About dichloromethane;2-(2-methylphenyl)acetic acid
dichloromethane;2-(2-methylphenyl)acetic acid (PubChem CID 174962889) has the molecular formula C10H12Cl2O2
and a molecular weight of 235.11 g/mol. Its IUPAC name is dichloromethane;2-(2-methylphenyl)acetic acid.
Molecular Properties
| Compound Name | dichloromethane;2-(2-methylphenyl)acetic acid |
| PubChem CID | 174962889 |
| Molecular Formula | C10H12Cl2O2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | dichloromethane;2-(2-methylphenyl)acetic acid |
| SMILES | Cc1ccccc1CC(=O)O.ClCCl |
| InChI | InChI=1S/C9H10O2.CH2Cl2/c1-7-4-2-3-5-8(7)6-9(10)11;2-1-3/h2-5H,6H2,1H3,(H,10,11);1H2 |
| InChIKey | YPPLNQOMYJZCKH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;2-(2-methylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;2-(2-methylphenyl)acetic acid?
The IUPAC name of dichloromethane;2-(2-methylphenyl)acetic acid (CID 174962889) is dichloromethane;2-(2-methylphenyl)acetic acid.
What is the SMILES notation for dichloromethane;2-(2-methylphenyl)acetic acid?
The canonical SMILES for dichloromethane;2-(2-methylphenyl)acetic acid is Cc1ccccc1CC(=O)O.ClCCl.
What is the InChIKey of dichloromethane;2-(2-methylphenyl)acetic acid?
The InChIKey is YPPLNQOMYJZCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.CH2Cl2/c1-7-4-2-3-5-8(7)6-9(10)11;2-1-3/h2-5H,6H2,1H3,(H,10,11);1H2.
What are the key properties of dichloromethane;2-(2-methylphenyl)acetic acid?
dichloromethane;2-(2-methylphenyl)acetic acid has a molecular weight of 235.11 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2-(2-methylphenyl)acetic acid is sourced from PubChem (CID 174962889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).