C10H9Cl3 — CID 71365855
1-methyl-2-(2,3,3-trichloroprop-2-enyl)benzene (PubChem CID 71365855) has the molecular formula C10H9Cl3 and a molecular weight of 235.54 g/mol. Its IUPAC name is 1-methyl-2-(2,3,3-trichloroprop-2-enyl)benzene.
| Compound Name | 1-methyl-2-(2,3,3-trichloroprop-2-enyl)benzene |
|---|---|
| PubChem CID | 71365855 |
| Molecular Formula | C10H9Cl3 |
| Molecular Weight | 235.54 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 1-methyl-2-(2,3,3-trichloroprop-2-enyl)benzene |
| SMILES | Cc1ccccc1CC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C10H9Cl3/c1-7-4-2-3-5-8(7)6-9(11)10(12)13/h2-5H,6H2,1H3 |
| InChIKey | JCGDTLXXGBBLML-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |