About acetic acid;1-ethyl-2-methylbenzene
acetic acid;1-ethyl-2-methylbenzene (PubChem CID 67948051) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is acetic acid;1-ethyl-2-methylbenzene.
Molecular Properties
| Compound Name | acetic acid;1-ethyl-2-methylbenzene |
| PubChem CID | 67948051 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | acetic acid;1-ethyl-2-methylbenzene |
| SMILES | CC(=O)O.CCc1ccccc1C |
| InChI | InChI=1S/C9H12.C2H4O2/c1-3-9-7-5-4-6-8(9)2;1-2(3)4/h4-7H,3H2,1-2H3;1H3,(H,3,4) |
| InChIKey | LVCLYJIOARLCPI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;1-ethyl-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-ethyl-2-methylbenzene?
The IUPAC name of acetic acid;1-ethyl-2-methylbenzene (CID 67948051) is acetic acid;1-ethyl-2-methylbenzene.
What is the SMILES notation for acetic acid;1-ethyl-2-methylbenzene?
The canonical SMILES for acetic acid;1-ethyl-2-methylbenzene is CC(=O)O.CCc1ccccc1C.
What is the InChIKey of acetic acid;1-ethyl-2-methylbenzene?
The InChIKey is LVCLYJIOARLCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C2H4O2/c1-3-9-7-5-4-6-8(9)2;1-2(3)4/h4-7H,3H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-ethyl-2-methylbenzene?
acetic acid;1-ethyl-2-methylbenzene has a molecular weight of 180.25 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-ethyl-2-methylbenzene is sourced from PubChem (CID 67948051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).